C13H21N3O — CID 20794231
(E)-3-(dimethylamino)-2-(3,3,4,4-tetramethyl-2-oxopyrrolidin-1-yl)prop-2-enenitrile (PubChem CID 20794231) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-2-(3,3,4,4-tetramethyl-2-oxopyrrolidin-1-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(dimethylamino)-2-(3,3,4,4-tetramethyl-2-oxopyrrolidin-1-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 20794231 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | (E)-3-(dimethylamino)-2-(3,3,4,4-tetramethyl-2-oxopyrrolidin-1-yl)prop-2-enenitrile |
| SMILES | CN(C)/C=C(\C#N)N1CC(C)(C)C(C)(C)C1=O |
| InChI | InChI=1S/C13H21N3O/c1-12(2)9-16(11(17)13(12,3)4)10(7-14)8-15(5)6/h8H,9H2,1-6H3/b10-8+ |
| InChIKey | FZNSYENBQPWHMY-CSKARUKUSA-N |
| XLogP | 1.81 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|