C28H37F2N3O — CID 20794499
1-[4-[bis(4-fluorophenyl)methyl]-2-tert-butylpiperazin-1-yl]-2-piperidin-4-ylethanone (PubChem CID 20794499) has the molecular formula C28H37F2N3O and a molecular weight of 469.62 g/mol. Its IUPAC name is 1-[4-[bis(4-fluorophenyl)methyl]-2-tert-butylpiperazin-1-yl]-2-piperidin-4-ylethanone.
| Compound Name | 1-[4-[bis(4-fluorophenyl)methyl]-2-tert-butylpiperazin-1-yl]-2-piperidin-4-ylethanone |
|---|---|
| PubChem CID | 20794499 |
| Molecular Formula | C28H37F2N3O |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | 1-[4-[bis(4-fluorophenyl)methyl]-2-tert-butylpiperazin-1-yl]-2-piperidin-4-ylethanone |
| SMILES | CC(C)(C)C1CN(C(c2ccc(F)cc2)c2ccc(F)cc2)CCN1C(=O)CC1CCNCC1 |
| InChI | InChI=1S/C28H37F2N3O/c1-28(2,3)25-19-32(16-17-33(25)26(34)18-20-12-14-31-15-13-20)27(21-4-8-23(29)9-5-21)22-6-10-24(30)11-7-22/h4-11,20,25,27,31H,12-19H2,1-3H3 |
| InChIKey | YGDQQDFJMVTESC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |