About 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole
5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole (PubChem CID 20794883) has the molecular formula C14H9ClF2O2
and a molecular weight of 282.67 g/mol. Its IUPAC name is 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole |
| PubChem CID | 20794883 |
| Molecular Formula | C14H9ClF2O2 |
| Molecular Weight | 282.67 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole |
| SMILES | FC1(F)Oc2ccc(C(Cl)c3ccccc3)cc2O1 |
| InChI | InChI=1S/C14H9ClF2O2/c15-13(9-4-2-1-3-5-9)10-6-7-11-12(8-10)19-14(16,17)18-11/h1-8,13H |
| InChIKey | IMAQSLKTPDNAHM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.67 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole?
The IUPAC name of 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole (CID 20794883) is 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole.
What is the SMILES notation for 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole?
The canonical SMILES for 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole is FC1(F)Oc2ccc(C(Cl)c3ccccc3)cc2O1.
What is the InChIKey of 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole?
The InChIKey is IMAQSLKTPDNAHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClF2O2/c15-13(9-4-2-1-3-5-9)10-6-7-11-12(8-10)19-14(16,17)18-11/h1-8,13H.
What are the key properties of 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole?
5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole has a molecular weight of 282.67 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[chloro(phenyl)methyl]-2,2-difluoro-1,3-benzodioxole is sourced from PubChem (CID 20794883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).