C23H26Cl3N5O2 — CID 20795142
(2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-[6-[2-(dimethylamino)ethylamino]-3-pyridinyl]-2-methoxypenta-2,4-dienamide;hydrochloride (PubChem CID 20795142) has the molecular formula C23H26Cl3N5O2 and a molecular weight of 510.85 g/mol. Its IUPAC name is (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-[6-[2-(dimethylamino)ethylamino]-3-pyridinyl]-2-methoxypenta-2,4-dienamide;hydrochloride.
| Compound Name | (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-[6-[2-(dimethylamino)ethylamino]-3-pyridinyl]-2-methoxypenta-2,4-dienamide;hydrochloride |
|---|---|
| PubChem CID | 20795142 |
| Molecular Formula | C23H26Cl3N5O2 |
| Molecular Weight | 510.85 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-[6-[2-(dimethylamino)ethylamino]-3-pyridinyl]-2-methoxypenta-2,4-dienamide;hydrochloride |
| SMILES | CO/C(=C\C=C\c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)Nc1ccc(NCCN(C)C)nc1.Cl |
| InChI | InChI=1S/C23H25Cl2N5O2.ClH/c1-30(2)10-9-26-22-8-7-17(14-27-22)29-23(31)21(32-3)6-4-5-16-11-15-12-18(24)19(25)13-20(15)28-16;/h4-8,11-14,28H,9-10H2,1-3H3,(H,26,27)(H,29,31);1H/b5-4+,21-6-; |
| InChIKey | MNAPCFXBOUTWRE-QNLABDDISA-N |
| XLogP | 5.45 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.85 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|