C17H25N3O — CID 20795356
(4-butylpiperazin-1-yl)-(1,3-dihydroisoindol-2-yl)methanone (PubChem CID 20795356) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (4-butylpiperazin-1-yl)-(1,3-dihydroisoindol-2-yl)methanone.
| Compound Name | (4-butylpiperazin-1-yl)-(1,3-dihydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 20795356 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (4-butylpiperazin-1-yl)-(1,3-dihydroisoindol-2-yl)methanone |
| SMILES | CCCCN1CCN(C(=O)N2Cc3ccccc3C2)CC1 |
| InChI | InChI=1S/C17H25N3O/c1-2-3-8-18-9-11-19(12-10-18)17(21)20-13-15-6-4-5-7-16(15)14-20/h4-7H,2-3,8-14H2,1H3 |
| InChIKey | ONZIOFNDCSLCRS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |