C25H22F3N5O4 — CID 20795632
3-[[2,5-dioxo-1-phenyl-4-[[2,2,2-trifluoro-1-(1H-pyrrol-2-yl)ethyl]amino]pyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 20795632) has the molecular formula C25H22F3N5O4 and a molecular weight of 513.48 g/mol. Its IUPAC name is 3-[[2,5-dioxo-1-phenyl-4-[[2,2,2-trifluoro-1-(1H-pyrrol-2-yl)ethyl]amino]pyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[2,5-dioxo-1-phenyl-4-[[2,2,2-trifluoro-1-(1H-pyrrol-2-yl)ethyl]amino]pyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 20795632 |
| Molecular Formula | C25H22F3N5O4 |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 3-[[2,5-dioxo-1-phenyl-4-[[2,2,2-trifluoro-1-(1H-pyrrol-2-yl)ethyl]amino]pyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NC2=C(NC(c3ccc[nH]3)C(F)(F)F)C(=O)N(c3ccccc3)C2=O)c1O |
| InChI | InChI=1S/C25H22F3N5O4/c1-32(2)22(35)15-10-6-11-16(20(15)34)30-18-19(31-21(25(26,27)28)17-12-7-13-29-17)24(37)33(23(18)36)14-8-4-3-5-9-14/h3-13,21,29-31,34H,1-2H3 |
| InChIKey | ULPQSDIQNSRVJM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|