C9H15NO3S2 — CID 20795759
3-hydroxy-N,N-dimethyl-4-propan-2-ylthiophene-2-sulfonamide (PubChem CID 20795759) has the molecular formula C9H15NO3S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is 3-hydroxy-N,N-dimethyl-4-propan-2-ylthiophene-2-sulfonamide.
| Compound Name | 3-hydroxy-N,N-dimethyl-4-propan-2-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20795759 |
| Molecular Formula | C9H15NO3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 3-hydroxy-N,N-dimethyl-4-propan-2-ylthiophene-2-sulfonamide |
| SMILES | CC(C)c1csc(S(=O)(=O)N(C)C)c1O |
| InChI | InChI=1S/C9H15NO3S2/c1-6(2)7-5-14-9(8(7)11)15(12,13)10(3)4/h5-6,11H,1-4H3 |
| InChIKey | MGWQDHKCSLMTSQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|