C12H12ClN5O4 — CID 20795840
6-[(4-chloro-1-methyl-2,5-dioxopyrrol-3-yl)amino]-5-hydroxy-N,N-dimethylpyrimidine-4-carboxamide (PubChem CID 20795840) has the molecular formula C12H12ClN5O4 and a molecular weight of 325.71 g/mol. Its IUPAC name is 6-[(4-chloro-1-methyl-2,5-dioxopyrrol-3-yl)amino]-5-hydroxy-N,N-dimethylpyrimidine-4-carboxamide.
| Compound Name | 6-[(4-chloro-1-methyl-2,5-dioxopyrrol-3-yl)amino]-5-hydroxy-N,N-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 20795840 |
| Molecular Formula | C12H12ClN5O4 |
| Molecular Weight | 325.71 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 6-[(4-chloro-1-methyl-2,5-dioxopyrrol-3-yl)amino]-5-hydroxy-N,N-dimethylpyrimidine-4-carboxamide |
| SMILES | CN(C)C(=O)c1ncnc(NC2=C(Cl)C(=O)N(C)C2=O)c1O |
| InChI | InChI=1S/C12H12ClN5O4/c1-17(2)11(21)7-8(19)9(15-4-14-7)16-6-5(13)10(20)18(3)12(6)22/h4,19H,1-3H3,(H,14,15,16) |
| InChIKey | DTKVUUZROHGUBZ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.71 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|