C23H25N5O5 — CID 20795900
5-[(4-hydroxy-2,5-dimethoxyphenyl)methyl]-N'-(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)furan-2-carbohydrazide (PubChem CID 20795900) has the molecular formula C23H25N5O5 and a molecular weight of 451.48 g/mol. Its IUPAC name is 5-[(4-hydroxy-2,5-dimethoxyphenyl)methyl]-N'-(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)furan-2-carbohydrazide.
| Compound Name | 5-[(4-hydroxy-2,5-dimethoxyphenyl)methyl]-N'-(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 20795900 |
| Molecular Formula | C23H25N5O5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 5-[(4-hydroxy-2,5-dimethoxyphenyl)methyl]-N'-(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)furan-2-carbohydrazide |
| SMILES | COc1cc(Cc2ccc(C(=O)NNc3cc(C)c4c(C)nn(C)c4n3)o2)c(OC)cc1O |
| InChI | InChI=1S/C23H25N5O5/c1-12-8-20(24-22-21(12)13(2)27-28(22)3)25-26-23(30)17-7-6-15(33-17)9-14-10-19(32-5)16(29)11-18(14)31-4/h6-8,10-11,29H,9H2,1-5H3,(H,24,25)(H,26,30) |
| InChIKey | SIUGLVLFEPYUGD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 123.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|