About 2-methoxy-N,N-dimethylbut-3-en-1-amine
2-methoxy-N,N-dimethylbut-3-en-1-amine (PubChem CID 20798624) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethylbut-3-en-1-amine.
Molecular Properties
| Compound Name | 2-methoxy-N,N-dimethylbut-3-en-1-amine |
| PubChem CID | 20798624 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 2-methoxy-N,N-dimethylbut-3-en-1-amine |
| SMILES | C=CC(CN(C)C)OC |
| InChI | InChI=1S/C7H15NO/c1-5-7(9-4)6-8(2)3/h5,7H,1,6H2,2-4H3 |
| InChIKey | CGISNRRHKBTXGB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N,N-dimethylbut-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N,N-dimethylbut-3-en-1-amine?
The IUPAC name of 2-methoxy-N,N-dimethylbut-3-en-1-amine (CID 20798624) is 2-methoxy-N,N-dimethylbut-3-en-1-amine.
What is the SMILES notation for 2-methoxy-N,N-dimethylbut-3-en-1-amine?
The canonical SMILES for 2-methoxy-N,N-dimethylbut-3-en-1-amine is C=CC(CN(C)C)OC.
What is the InChIKey of 2-methoxy-N,N-dimethylbut-3-en-1-amine?
The InChIKey is CGISNRRHKBTXGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO/c1-5-7(9-4)6-8(2)3/h5,7H,1,6H2,2-4H3.
What are the key properties of 2-methoxy-N,N-dimethylbut-3-en-1-amine?
2-methoxy-N,N-dimethylbut-3-en-1-amine has a molecular weight of 129.20 g/mol, XLogP of 0.75, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N,N-dimethylbut-3-en-1-amine is sourced from PubChem (CID 20798624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).