C23H30O6 — CID 20798745
9-O-(3,3-dimethylbutyl) 10-O-propyl 4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 20798745) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is 9-O-(3,3-dimethylbutyl) 10-O-propyl 4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 9-O-(3,3-dimethylbutyl) 10-O-propyl 4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 20798745 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 9-O-(3,3-dimethylbutyl) 10-O-propyl 4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | CCCOC(=O)C1C2C(=O)CC(c3ccc(O)cc32)C1C(=O)OCCC(C)(C)C |
| InChI | InChI=1S/C23H30O6/c1-5-9-28-22(27)20-18-15-11-13(24)6-7-14(15)16(12-17(18)25)19(20)21(26)29-10-8-23(2,3)4/h6-7,11,16,18-20,24H,5,8-10,12H2,1-4H3 |
| InChIKey | YNMRJIMLEOQFSB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |