C23H32O6Si — CID 20798746
10-O-propyl 9-O-(3-trimethylsilylpropyl) 4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 20798746) has the molecular formula C23H32O6Si and a molecular weight of 432.59 g/mol. Its IUPAC name is 10-O-propyl 9-O-(3-trimethylsilylpropyl) 4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 10-O-propyl 9-O-(3-trimethylsilylpropyl) 4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 20798746 |
| Molecular Formula | C23H32O6Si |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 10-O-propyl 9-O-(3-trimethylsilylpropyl) 4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | CCCOC(=O)C1C2C(=O)CC(c3ccc(O)cc32)C1C(=O)OCCC[Si](C)(C)C |
| InChI | InChI=1S/C23H32O6Si/c1-5-9-28-23(27)21-19-16-12-14(24)7-8-15(16)17(13-18(19)25)20(21)22(26)29-10-6-11-30(2,3)4/h7-8,12,17,19-21,24H,5-6,9-11,13H2,1-4H3 |
| InChIKey | LKMPYIABNGXFSQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|