C22H28O6Si — CID 20798843
10-O-prop-2-enyl 9-O-(2-trimethylsilylethyl) 4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate (PubChem CID 20798843) has the molecular formula C22H28O6Si and a molecular weight of 416.55 g/mol. Its IUPAC name is 10-O-prop-2-enyl 9-O-(2-trimethylsilylethyl) 4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate.
| Compound Name | 10-O-prop-2-enyl 9-O-(2-trimethylsilylethyl) 4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 20798843 |
| Molecular Formula | C22H28O6Si |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 10-O-prop-2-enyl 9-O-(2-trimethylsilylethyl) 4-hydroxy-11-oxotricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylate |
| SMILES | C=CCOC(=O)C1C2C(=O)CC(c3ccc(O)cc32)C1C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C22H28O6Si/c1-5-8-27-22(26)20-18-15-11-13(23)6-7-14(15)16(12-17(18)24)19(20)21(25)28-9-10-29(2,3)4/h5-7,11,16,18-20,23H,1,8-10,12H2,2-4H3 |
| InChIKey | GDUZENNEBKADCK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|