C20H12Cl3N3O5S2 — CID 20799264
1-[4-(6-chloro-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]-3-(4,5-dichlorothiophen-2-yl)sulfonylurea (PubChem CID 20799264) has the molecular formula C20H12Cl3N3O5S2 and a molecular weight of 544.83 g/mol. Its IUPAC name is 1-[4-(6-chloro-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]-3-(4,5-dichlorothiophen-2-yl)sulfonylurea.
| Compound Name | 1-[4-(6-chloro-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]-3-(4,5-dichlorothiophen-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 20799264 |
| Molecular Formula | C20H12Cl3N3O5S2 |
| Molecular Weight | 544.83 g/mol |
| Exact Mass | 542.93 |
| IUPAC Name | 1-[4-(6-chloro-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]-3-(4,5-dichlorothiophen-2-yl)sulfonylurea |
| SMILES | O=C(Nc1ccc(N2C(=O)Cc3cc(Cl)ccc3C2=O)cc1)NS(=O)(=O)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C20H12Cl3N3O5S2/c21-11-1-6-14-10(7-11)8-16(27)26(19(14)28)13-4-2-12(3-5-13)24-20(29)25-33(30,31)17-9-15(22)18(23)32-17/h1-7,9H,8H2,(H2,24,25,29) |
| InChIKey | IYRQPSUSUALDEF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.83 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|