C26H27FN6O5S2 — CID 20799343
1-[6-[1,3-dioxo-6-(3-pyrrolidin-1-ylpropylamino)-4H-isoquinolin-2-yl]-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea (PubChem CID 20799343) has the molecular formula C26H27FN6O5S2 and a molecular weight of 586.67 g/mol. Its IUPAC name is 1-[6-[1,3-dioxo-6-(3-pyrrolidin-1-ylpropylamino)-4H-isoquinolin-2-yl]-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea.
| Compound Name | 1-[6-[1,3-dioxo-6-(3-pyrrolidin-1-ylpropylamino)-4H-isoquinolin-2-yl]-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 20799343 |
| Molecular Formula | C26H27FN6O5S2 |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | 1-[6-[1,3-dioxo-6-(3-pyrrolidin-1-ylpropylamino)-4H-isoquinolin-2-yl]-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea |
| SMILES | O=C(Nc1ccc(N2C(=O)Cc3cc(NCCCN4CCCC4)ccc3C2=O)nc1)NS(=O)(=O)c1ccc(F)s1 |
| InChI | InChI=1S/C26H27FN6O5S2/c27-21-7-9-24(39-21)40(37,38)31-26(36)30-19-5-8-22(29-16-19)33-23(34)15-17-14-18(4-6-20(17)25(33)35)28-10-3-13-32-11-1-2-12-32/h4-9,14,16,28H,1-3,10-13,15H2,(H2,30,31,36) |
| InChIKey | BKEDLRNJRHVOQE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 140.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|