C22H20FN5O5S2 — CID 20799345
1-[6-[1,3-dioxo-6-(propylamino)-4H-isoquinolin-2-yl]-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea (PubChem CID 20799345) has the molecular formula C22H20FN5O5S2 and a molecular weight of 517.56 g/mol. Its IUPAC name is 1-[6-[1,3-dioxo-6-(propylamino)-4H-isoquinolin-2-yl]-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea.
| Compound Name | 1-[6-[1,3-dioxo-6-(propylamino)-4H-isoquinolin-2-yl]-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 20799345 |
| Molecular Formula | C22H20FN5O5S2 |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 1-[6-[1,3-dioxo-6-(propylamino)-4H-isoquinolin-2-yl]-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea |
| SMILES | CCCNc1ccc2c(c1)CC(=O)N(c1ccc(NC(=O)NS(=O)(=O)c3ccc(F)s3)cn1)C2=O |
| InChI | InChI=1S/C22H20FN5O5S2/c1-2-9-24-14-3-5-16-13(10-14)11-19(29)28(21(16)30)18-7-4-15(12-25-18)26-22(31)27-35(32,33)20-8-6-17(23)34-20/h3-8,10,12,24H,2,9,11H2,1H3,(H2,26,27,31) |
| InChIKey | BQBCWZFUBLTWDF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|