C21H25N3O4S2 — CID 2079942
N,N-diethyl-3-[5-[2-(2-methylphenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonamide (PubChem CID 2079942) has the molecular formula C21H25N3O4S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is N,N-diethyl-3-[5-[2-(2-methylphenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[5-[2-(2-methylphenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2079942 |
| Molecular Formula | C21H25N3O4S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N,N-diethyl-3-[5-[2-(2-methylphenoxy)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCCOc3ccccc3C)o2)c1 |
| InChI | InChI=1S/C21H25N3O4S2/c1-4-24(5-2)30(25,26)18-11-8-10-17(15-18)20-22-23-21(28-20)29-14-13-27-19-12-7-6-9-16(19)3/h6-12,15H,4-5,13-14H2,1-3H3 |
| InChIKey | RIJREDFJPNNFFC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|