C21H16ClFN4O6S3 — CID 20799575
1-(5-chlorothiophen-2-yl)sulfonyl-3-[3-fluoro-4-(2-methyl-6-methylperoxysulfanyl-4-oxoquinazolin-3-yl)phenyl]urea (PubChem CID 20799575) has the molecular formula C21H16ClFN4O6S3 and a molecular weight of 571.03 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[3-fluoro-4-(2-methyl-6-methylperoxysulfanyl-4-oxoquinazolin-3-yl)phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[3-fluoro-4-(2-methyl-6-methylperoxysulfanyl-4-oxoquinazolin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 20799575 |
| Molecular Formula | C21H16ClFN4O6S3 |
| Molecular Weight | 571.03 g/mol |
| Exact Mass | 569.99 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[3-fluoro-4-(2-methyl-6-methylperoxysulfanyl-4-oxoquinazolin-3-yl)phenyl]urea |
| SMILES | COOSc1ccc2nc(C)n(-c3ccc(NC(=O)NS(=O)(=O)c4ccc(Cl)s4)cc3F)c(=O)c2c1 |
| InChI | InChI=1S/C21H16ClFN4O6S3/c1-11-24-16-5-4-13(35-33-32-2)10-14(16)20(28)27(11)17-6-3-12(9-15(17)23)25-21(29)26-36(30,31)19-8-7-18(22)34-19/h3-10H,1-2H3,(H2,25,26,29) |
| InChIKey | RUGHMECXXBQSJY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.03 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|