C23H20ClFN4O5S2 — CID 20799663
1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[1,3-dioxo-6-(propylamino)-4H-isoquinolin-2-yl]-3-fluorophenyl]urea (PubChem CID 20799663) has the molecular formula C23H20ClFN4O5S2 and a molecular weight of 551.02 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[1,3-dioxo-6-(propylamino)-4H-isoquinolin-2-yl]-3-fluorophenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[1,3-dioxo-6-(propylamino)-4H-isoquinolin-2-yl]-3-fluorophenyl]urea |
|---|---|
| PubChem CID | 20799663 |
| Molecular Formula | C23H20ClFN4O5S2 |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[1,3-dioxo-6-(propylamino)-4H-isoquinolin-2-yl]-3-fluorophenyl]urea |
| SMILES | CCCNc1ccc2c(c1)CC(=O)N(c1ccc(NC(=O)NS(=O)(=O)c3ccc(Cl)s3)cc1F)C2=O |
| InChI | InChI=1S/C23H20ClFN4O5S2/c1-2-9-26-14-3-5-16-13(10-14)11-20(30)29(22(16)31)18-6-4-15(12-17(18)25)27-23(32)28-36(33,34)21-8-7-19(24)35-21/h3-8,10,12,26H,2,9,11H2,1H3,(H2,27,28,32) |
| InChIKey | INEGUNKAVRVPQK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|