C21H16FN5O5S2 — CID 20800168
1-[6-(5,7-dioxo-1,2,3,8-tetrahydropyrrolo[2,3-g]isoquinolin-6-yl)-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea (PubChem CID 20800168) has the molecular formula C21H16FN5O5S2 and a molecular weight of 501.52 g/mol. Its IUPAC name is 1-[6-(5,7-dioxo-1,2,3,8-tetrahydropyrrolo[2,3-g]isoquinolin-6-yl)-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea.
| Compound Name | 1-[6-(5,7-dioxo-1,2,3,8-tetrahydropyrrolo[2,3-g]isoquinolin-6-yl)-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 20800168 |
| Molecular Formula | C21H16FN5O5S2 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 1-[6-(5,7-dioxo-1,2,3,8-tetrahydropyrrolo[2,3-g]isoquinolin-6-yl)-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea |
| SMILES | O=C(Nc1ccc(N2C(=O)Cc3cc4c(cc3C2=O)CCN4)nc1)NS(=O)(=O)c1ccc(F)s1 |
| InChI | InChI=1S/C21H16FN5O5S2/c22-16-2-4-19(33-16)34(31,32)26-21(30)25-13-1-3-17(24-10-13)27-18(28)9-12-8-15-11(5-6-23-15)7-14(12)20(27)29/h1-4,7-8,10,23H,5-6,9H2,(H2,25,26,30) |
| InChIKey | KHIKTHFHIFSUAJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|