About 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane
2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 20800744) has the molecular formula C13H26N2
and a molecular weight of 210.37 g/mol. Its IUPAC name is 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane |
| PubChem CID | 20800744 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CC(C)CN1CC2CC1CN2CC(C)C |
| InChI | InChI=1S/C13H26N2/c1-10(2)6-14-8-13-5-12(14)9-15(13)7-11(3)4/h10-13H,5-9H2,1-4H3 |
| InChIKey | ATSUDOWOSJPVGI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane (CID 20800744) is 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane is CC(C)CN1CC2CC1CN2CC(C)C.
What is the InChIKey of 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is ATSUDOWOSJPVGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-10(2)6-14-8-13-5-12(14)9-15(13)7-11(3)4/h10-13H,5-9H2,1-4H3.
What are the key properties of 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane?
2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 210.37 g/mol, XLogP of 2.06, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(2-methylpropyl)-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 20800744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).