About 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole
6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole (PubChem CID 20800991) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole.
Molecular Properties
| Compound Name | 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole |
| PubChem CID | 20800991 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole |
| SMILES | COc1ccc2c(C(C)CC(C)C)noc2c1OC |
| InChI | InChI=1S/C15H21NO3/c1-9(2)8-10(3)13-11-6-7-12(17-4)15(18-5)14(11)19-16-13/h6-7,9-10H,8H2,1-5H3 |
| InChIKey | XNBZFZGPBLKZLV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole?
The IUPAC name of 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole (CID 20800991) is 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole.
What is the SMILES notation for 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole?
The canonical SMILES for 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole is COc1ccc2c(C(C)CC(C)C)noc2c1OC.
What is the InChIKey of 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole?
The InChIKey is XNBZFZGPBLKZLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-9(2)8-10(3)13-11-6-7-12(17-4)15(18-5)14(11)19-16-13/h6-7,9-10H,8H2,1-5H3.
What are the key properties of 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole?
6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole has a molecular weight of 263.34 g/mol, XLogP of 3.99, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-3-(4-methylpentan-2-yl)-1,2-benzoxazole is sourced from PubChem (CID 20800991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).