About 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane]
2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane] (PubChem CID 20801257) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane].
Molecular Properties
| Compound Name | 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane] |
| PubChem CID | 20801257 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane] |
| SMILES | CC1C(C)C12COc1ccccc12 |
| InChI | InChI=1S/C12H14O/c1-8-9(2)12(8)7-13-11-6-4-3-5-10(11)12/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | ZKIDTSQERPBAEF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane]?
The IUPAC name of 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane] (CID 20801257) is 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane].
What is the SMILES notation for 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane]?
The canonical SMILES for 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane] is CC1C(C)C12COc1ccccc12.
What is the InChIKey of 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane]?
The InChIKey is ZKIDTSQERPBAEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O/c1-8-9(2)12(8)7-13-11-6-4-3-5-10(11)12/h3-6,8-9H,7H2,1-2H3.
What are the key properties of 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane]?
2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane] has a molecular weight of 174.24 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2',3'-dimethylspiro[2H-1-benzofuran-3,1'-cyclopropane] is sourced from PubChem (CID 20801257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).