C25H11N3O — CID 20802004
2-(benzotriazol-2-yl)-6-dodeca-1,3,5,7,9,11-hexaynyl-4-methylphenol (PubChem CID 20802004) has the molecular formula C25H11N3O and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-6-dodeca-1,3,5,7,9,11-hexaynyl-4-methylphenol.
| Compound Name | 2-(benzotriazol-2-yl)-6-dodeca-1,3,5,7,9,11-hexaynyl-4-methylphenol |
|---|---|
| PubChem CID | 20802004 |
| Molecular Formula | C25H11N3O |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-(benzotriazol-2-yl)-6-dodeca-1,3,5,7,9,11-hexaynyl-4-methylphenol |
| SMILES | C#CC#CC#CC#CC#CC#Cc1cc(C)cc(-n2nc3ccccc3n2)c1O |
| InChI | InChI=1S/C25H11N3O/c1-3-4-5-6-7-8-9-10-11-12-15-21-18-20(2)19-24(25(21)29)28-26-22-16-13-14-17-23(22)27-28/h1,13-14,16-19,29H,2H3 |
| InChIKey | OXADXFINFMOKTP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|