C6H5F7O — CID 20802051
2-(ethenoxymethyl)-1,1,1,2,3,3,3-heptafluoropropane (PubChem CID 20802051) has the molecular formula C6H5F7O and a molecular weight of 226.09 g/mol. Its IUPAC name is 2-(ethenoxymethyl)-1,1,1,2,3,3,3-heptafluoropropane.
| Compound Name | 2-(ethenoxymethyl)-1,1,1,2,3,3,3-heptafluoropropane |
|---|---|
| PubChem CID | 20802051 |
| Molecular Formula | C6H5F7O |
| Molecular Weight | 226.09 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 2-(ethenoxymethyl)-1,1,1,2,3,3,3-heptafluoropropane |
| SMILES | C=COCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H5F7O/c1-2-14-3-4(7,5(8,9)10)6(11,12)13/h2H,1,3H2 |
| InChIKey | XLFHBCNQGAXTPB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.09 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|