C8H8F6 — CID 20802222
1,2,3,3,6,6-hexafluoro-4,5-dimethylcyclohexene (PubChem CID 20802222) has the molecular formula C8H8F6 and a molecular weight of 218.14 g/mol. Its IUPAC name is 1,2,3,3,6,6-hexafluoro-4,5-dimethylcyclohexene.
| Compound Name | 1,2,3,3,6,6-hexafluoro-4,5-dimethylcyclohexene |
|---|---|
| PubChem CID | 20802222 |
| Molecular Formula | C8H8F6 |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 1,2,3,3,6,6-hexafluoro-4,5-dimethylcyclohexene |
| SMILES | CC1C(C)C(F)(F)C(F)=C(F)C1(F)F |
| InChI | InChI=1S/C8H8F6/c1-3-4(2)8(13,14)6(10)5(9)7(3,11)12/h3-4H,1-2H3 |
| InChIKey | WVCZXOBWTFNTTF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |