C11H9F13O — CID 20802292
3,3,4,4-tetrafluoro-2-(trifluoromethyl)-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propoxy]pent-1-ene (PubChem CID 20802292) has the molecular formula C11H9F13O and a molecular weight of 404.17 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-2-(trifluoromethyl)-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propoxy]pent-1-ene.
| Compound Name | 3,3,4,4-tetrafluoro-2-(trifluoromethyl)-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propoxy]pent-1-ene |
|---|---|
| PubChem CID | 20802292 |
| Molecular Formula | C11H9F13O |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 3,3,4,4-tetrafluoro-2-(trifluoromethyl)-5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propoxy]pent-1-ene |
| SMILES | C=C(C(F)(F)F)C(F)(F)C(F)(F)COCC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H9F13O/c1-5(9(16,17)18)8(14,15)7(12,13)4-25-3-6(2,10(19,20)21)11(22,23)24/h1,3-4H2,2H3 |
| InChIKey | PUGYHJYWVACBEZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|