C11H11F7 — CID 20802338
5-fluoro-5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)bicyclo[2.2.1]hept-2-ene (PubChem CID 20802338) has the molecular formula C11H11F7 and a molecular weight of 276.20 g/mol. Its IUPAC name is 5-fluoro-5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-fluoro-5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 20802338 |
| Molecular Formula | C11H11F7 |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 5-fluoro-5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)bicyclo[2.2.1]hept-2-ene |
| SMILES | CC(C(F)(F)F)(C(F)(F)F)C1(F)CC2C=CC1C2 |
| InChI | InChI=1S/C11H11F7/c1-8(10(13,14)15,11(16,17)18)9(12)5-6-2-3-7(9)4-6/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | NATNZGNKHJKTRN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|