C16H12F7S+ — CID 20802364
diphenyl-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]sulfanium (PubChem CID 20802364) has the molecular formula C16H12F7S+ and a molecular weight of 369.32 g/mol. Its IUPAC name is diphenyl-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]sulfanium.
| Compound Name | diphenyl-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]sulfanium |
|---|---|
| PubChem CID | 20802364 |
| Molecular Formula | C16H12F7S+ |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | diphenyl-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]sulfanium |
| SMILES | FC(F)(F)C(F)(C[S+](c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H12F7S/c17-14(15(18,19)20,16(21,22)23)11-24(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2/q+1 |
| InChIKey | INGKPZJZFBEUSI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|