C11H7F13O4 — CID 20802368
ethyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propanoate (PubChem CID 20802368) has the molecular formula C11H7F13O4 and a molecular weight of 450.15 g/mol. Its IUPAC name is ethyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propanoate.
| Compound Name | ethyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propanoate |
|---|---|
| PubChem CID | 20802368 |
| Molecular Formula | C11H7F13O4 |
| Molecular Weight | 450.15 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | ethyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propanoate |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C11H7F13O4/c1-3-26-5(25)6(13,9(17,18)19)27-11(23,24)8(16,10(20,21)22)28-7(14,15)4(2)12/h2-3H2,1H3 |
| InChIKey | DZMKOESXWKHKAO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.15 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |