C21H25NO5 — CID 20802543
2-[(3-butyl-4-methyl-2-oxo-1,3-benzoxazol-5-yl)-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 20802543) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 2-[(3-butyl-4-methyl-2-oxo-1,3-benzoxazol-5-yl)-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[(3-butyl-4-methyl-2-oxo-1,3-benzoxazol-5-yl)-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 20802543 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-[(3-butyl-4-methyl-2-oxo-1,3-benzoxazol-5-yl)-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CCCCn1c(=O)oc2ccc(C(O)=C3C(=O)CC(C)(C)CC3=O)c(C)c21 |
| InChI | InChI=1S/C21H25NO5/c1-5-6-9-22-18-12(2)13(7-8-16(18)27-20(22)26)19(25)17-14(23)10-21(3,4)11-15(17)24/h7-8,25H,5-6,9-11H2,1-4H3 |
| InChIKey | KFYKHPZSBOJMOV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|