C20H23NO5 — CID 20802560
2-[hydroxy-(4-methyl-2-oxo-3-propyl-1,3-benzoxazol-5-yl)methylidene]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 20802560) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-[hydroxy-(4-methyl-2-oxo-3-propyl-1,3-benzoxazol-5-yl)methylidene]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[hydroxy-(4-methyl-2-oxo-3-propyl-1,3-benzoxazol-5-yl)methylidene]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 20802560 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-[hydroxy-(4-methyl-2-oxo-3-propyl-1,3-benzoxazol-5-yl)methylidene]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CCCn1c(=O)oc2ccc(C(O)=C3C(=O)CC(C)(C)CC3=O)c(C)c21 |
| InChI | InChI=1S/C20H23NO5/c1-5-8-21-17-11(2)12(6-7-15(17)26-19(21)25)18(24)16-13(22)9-20(3,4)10-14(16)23/h6-7,24H,5,8-10H2,1-4H3 |
| InChIKey | QPOWFDKIGUGSFS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|