About 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one
1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one (PubChem CID 20802815) has the molecular formula C9H19N2O+
and a molecular weight of 171.26 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one |
| PubChem CID | 20802815 |
| Molecular Formula | C9H19N2O+ |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one |
| SMILES | CC(=O)C[N+]1(C)CCN(C)CC1 |
| InChI | InChI=1S/C9H19N2O/c1-9(12)8-11(3)6-4-10(2)5-7-11/h4-8H2,1-3H3/q+1 |
| InChIKey | TVQNKQQIPUKCED-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one?
The IUPAC name of 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one (CID 20802815) is 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one.
What is the SMILES notation for 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one?
The canonical SMILES for 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one is CC(=O)C[N+]1(C)CCN(C)CC1.
What is the InChIKey of 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one?
The InChIKey is TVQNKQQIPUKCED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N2O/c1-9(12)8-11(3)6-4-10(2)5-7-11/h4-8H2,1-3H3/q+1.
What are the key properties of 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one?
1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one has a molecular weight of 171.26 g/mol, XLogP of -0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dimethylpiperazin-1-ium-1-yl)propan-2-one is sourced from PubChem (CID 20802815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).