C19H19N3O — CID 20803055
1,4,5,7,8,9-hexahydroimidazo[4,5-d]azocin-6-yl(naphthalen-2-yl)methanone (PubChem CID 20803055) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 1,4,5,7,8,9-hexahydroimidazo[4,5-d]azocin-6-yl(naphthalen-2-yl)methanone.
| Compound Name | 1,4,5,7,8,9-hexahydroimidazo[4,5-d]azocin-6-yl(naphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 20803055 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1,4,5,7,8,9-hexahydroimidazo[4,5-d]azocin-6-yl(naphthalen-2-yl)methanone |
| SMILES | O=C(c1ccc2ccccc2c1)N1CCCc2[nH]cnc2CC1 |
| InChI | InChI=1S/C19H19N3O/c23-19(16-8-7-14-4-1-2-5-15(14)12-16)22-10-3-6-17-18(9-11-22)21-13-20-17/h1-2,4-5,7-8,12-13H,3,6,9-11H2,(H,20,21) |
| InChIKey | PUBZDVMXGXTFSU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |