C20H23N3O4S2 — CID 2080328
N,N-diethyl-3-[5-(2-phenoxyethylsulfanyl)-1,3,4-oxadiazol-2-yl]benzenesulfonamide (PubChem CID 2080328) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N,N-diethyl-3-[5-(2-phenoxyethylsulfanyl)-1,3,4-oxadiazol-2-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[5-(2-phenoxyethylsulfanyl)-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2080328 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N,N-diethyl-3-[5-(2-phenoxyethylsulfanyl)-1,3,4-oxadiazol-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCCOc3ccccc3)o2)c1 |
| InChI | InChI=1S/C20H23N3O4S2/c1-3-23(4-2)29(24,25)18-12-8-9-16(15-18)19-21-22-20(27-19)28-14-13-26-17-10-6-5-7-11-17/h5-12,15H,3-4,13-14H2,1-2H3 |
| InChIKey | MBAVXGNIVFYBIB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|