C34H36FNO4 — CID 20803529
3-[(3-fluorophenyl)methoxy]-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine (PubChem CID 20803529) has the molecular formula C34H36FNO4 and a molecular weight of 541.66 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methoxy]-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine.
| Compound Name | 3-[(3-fluorophenyl)methoxy]-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20803529 |
| Molecular Formula | C34H36FNO4 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 3-[(3-fluorophenyl)methoxy]-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine |
| SMILES | COc1ccc(CNc2ccc3c(c2)C(OCCc2ccccc2)C(OCc2cccc(F)c2)C(C)(C)O3)cc1 |
| InChI | InChI=1S/C34H36FNO4/c1-34(2)33(39-23-26-10-7-11-27(35)20-26)32(38-19-18-24-8-5-4-6-9-24)30-21-28(14-17-31(30)40-34)36-22-25-12-15-29(37-3)16-13-25/h4-17,20-21,32-33,36H,18-19,22-23H2,1-3H3 |
| InChIKey | NCXLBGDZJCEBNX-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|