C32H41NO3 — CID 20803899
4-(2-cyclohexylethoxy)-N-ethyl-2,2-dimethyl-3-(naphthalen-2-ylmethoxy)-3,4-dihydrochromen-6-amine (PubChem CID 20803899) has the molecular formula C32H41NO3 and a molecular weight of 487.68 g/mol. Its IUPAC name is 4-(2-cyclohexylethoxy)-N-ethyl-2,2-dimethyl-3-(naphthalen-2-ylmethoxy)-3,4-dihydrochromen-6-amine.
| Compound Name | 4-(2-cyclohexylethoxy)-N-ethyl-2,2-dimethyl-3-(naphthalen-2-ylmethoxy)-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20803899 |
| Molecular Formula | C32H41NO3 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | 4-(2-cyclohexylethoxy)-N-ethyl-2,2-dimethyl-3-(naphthalen-2-ylmethoxy)-3,4-dihydrochromen-6-amine |
| SMILES | CCNc1ccc2c(c1)C(OCCC1CCCCC1)C(OCc1ccc3ccccc3c1)C(C)(C)O2 |
| InChI | InChI=1S/C32H41NO3/c1-4-33-27-16-17-29-28(21-27)30(34-19-18-23-10-6-5-7-11-23)31(32(2,3)36-29)35-22-24-14-15-25-12-8-9-13-26(25)20-24/h8-9,12-17,20-21,23,30-31,33H,4-7,10-11,18-19,22H2,1-3H3 |
| InChIKey | LREZGVKJATUEKR-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|