C33H34FNO4 — CID 20803992
3-[(4-fluorophenyl)methoxy]-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-4-phenylmethoxy-3,4-dihydrochromen-6-amine (PubChem CID 20803992) has the molecular formula C33H34FNO4 and a molecular weight of 527.64 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methoxy]-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-4-phenylmethoxy-3,4-dihydrochromen-6-amine.
| Compound Name | 3-[(4-fluorophenyl)methoxy]-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-4-phenylmethoxy-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20803992 |
| Molecular Formula | C33H34FNO4 |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 3-[(4-fluorophenyl)methoxy]-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-4-phenylmethoxy-3,4-dihydrochromen-6-amine |
| SMILES | COc1ccc(CNc2ccc3c(c2)C(OCc2ccccc2)C(OCc2ccc(F)cc2)C(C)(C)O3)cc1 |
| InChI | InChI=1S/C33H34FNO4/c1-33(2)32(38-22-25-9-13-26(34)14-10-25)31(37-21-24-7-5-4-6-8-24)29-19-27(15-18-30(29)39-33)35-20-23-11-16-28(36-3)17-12-23/h4-19,31-32,35H,20-22H2,1-3H3 |
| InChIKey | ISKPHXKIRSZERY-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|