C28H33NO3 — CID 20804760
N-benzyl-2,2-dimethyl-3-phenylmethoxy-4-propan-2-yloxy-3,4-dihydrochromen-6-amine (PubChem CID 20804760) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-benzyl-2,2-dimethyl-3-phenylmethoxy-4-propan-2-yloxy-3,4-dihydrochromen-6-amine.
| Compound Name | N-benzyl-2,2-dimethyl-3-phenylmethoxy-4-propan-2-yloxy-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804760 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | N-benzyl-2,2-dimethyl-3-phenylmethoxy-4-propan-2-yloxy-3,4-dihydrochromen-6-amine |
| SMILES | CC(C)OC1c2cc(NCc3ccccc3)ccc2OC(C)(C)C1OCc1ccccc1 |
| InChI | InChI=1S/C28H33NO3/c1-20(2)31-26-24-17-23(29-18-21-11-7-5-8-12-21)15-16-25(24)32-28(3,4)27(26)30-19-22-13-9-6-10-14-22/h5-17,20,26-27,29H,18-19H2,1-4H3 |
| InChIKey | GLJYLCNOJASJTM-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|