About bis(benzene-1,2-dithiolate);iron(4+)
bis(benzene-1,2-dithiolate);iron(4+) (PubChem CID 20804881) has the molecular formula C12H8FeS4
and a molecular weight of 336.31 g/mol. Its IUPAC name is bis(benzene-1,2-dithiolate);iron(4+).
Molecular Properties
| Compound Name | bis(benzene-1,2-dithiolate);iron(4+) |
| PubChem CID | 20804881 |
| Molecular Formula | C12H8FeS4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 335.89 |
| IUPAC Name | bis(benzene-1,2-dithiolate);iron(4+) |
| SMILES | [Fe+4].[S-]c1ccccc1[S-].[S-]c1ccccc1[S-] |
| InChI | InChI=1S/2C6H6S2.Fe/c2*7-5-3-1-2-4-6(5)8;/h2*1-4,7-8H;/q;;+4/p-4 |
| InChIKey | KTNOFZWUQMMEBV-UHFFFAOYSA-J |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(benzene-1,2-dithiolate);iron(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzene-1,2-dithiolate);iron(4+)?
The IUPAC name of bis(benzene-1,2-dithiolate);iron(4+) (CID 20804881) is bis(benzene-1,2-dithiolate);iron(4+).
What is the SMILES notation for bis(benzene-1,2-dithiolate);iron(4+)?
The canonical SMILES for bis(benzene-1,2-dithiolate);iron(4+) is [Fe+4].[S-]c1ccccc1[S-].[S-]c1ccccc1[S-].
What is the InChIKey of bis(benzene-1,2-dithiolate);iron(4+)?
The InChIKey is KTNOFZWUQMMEBV-UHFFFAOYSA-J. The full InChI is InChI=1S/2C6H6S2.Fe/c2*7-5-3-1-2-4-6(5)8;/h2*1-4,7-8H;/q;;+4/p-4.
What are the key properties of bis(benzene-1,2-dithiolate);iron(4+)?
bis(benzene-1,2-dithiolate);iron(4+) has a molecular weight of 336.31 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzene-1,2-dithiolate);iron(4+) is sourced from PubChem (CID 20804881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).