C21H34O2 — CID 20805099
(8-tert-butyl-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl) 2-methylbutanoate (PubChem CID 20805099) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (8-tert-butyl-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl) 2-methylbutanoate.
| Compound Name | (8-tert-butyl-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 20805099 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (8-tert-butyl-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(C(C)(C)C)C21 |
| InChI | InChI=1S/C21H34O2/c1-8-14(3)20(22)23-17-12-13(2)11-16-10-9-15(4)19(18(16)17)21(5,6)7/h9-11,13-15,17-19H,8,12H2,1-7H3 |
| InChIKey | KXCAPVMISMQWPW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |