About 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole
5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole (PubChem CID 20805131) has the molecular formula C11H21NS2
and a molecular weight of 231.43 g/mol. Its IUPAC name is 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole |
| PubChem CID | 20805131 |
| Molecular Formula | C11H21NS2 |
| Molecular Weight | 231.43 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole |
| SMILES | CCSC(SCC)C1C=C(C)C(C)N1 |
| InChI | InChI=1S/C11H21NS2/c1-5-13-11(14-6-2)10-7-8(3)9(4)12-10/h7,9-12H,5-6H2,1-4H3 |
| InChIKey | HORDGZBNLDZTTG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole?
The IUPAC name of 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole (CID 20805131) is 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole.
What is the SMILES notation for 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole?
The canonical SMILES for 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole is CCSC(SCC)C1C=C(C)C(C)N1.
What is the InChIKey of 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole?
The InChIKey is HORDGZBNLDZTTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NS2/c1-5-13-11(14-6-2)10-7-8(3)9(4)12-10/h7,9-12H,5-6H2,1-4H3.
What are the key properties of 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole?
5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole has a molecular weight of 231.43 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bis(ethylsulfanyl)methyl]-2,3-dimethyl-2,5-dihydro-1H-pyrrole is sourced from PubChem (CID 20805131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).