C30H42N2O11S — CID 20805165
[2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 2-acetamido-3-(4-nitrooxybutanoylsulfanyl)propanoate (PubChem CID 20805165) has the molecular formula C30H42N2O11S and a molecular weight of 638.74 g/mol. Its IUPAC name is [2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 2-acetamido-3-(4-nitrooxybutanoylsulfanyl)propanoate.
| Compound Name | [2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 2-acetamido-3-(4-nitrooxybutanoylsulfanyl)propanoate |
|---|---|
| PubChem CID | 20805165 |
| Molecular Formula | C30H42N2O11S |
| Molecular Weight | 638.74 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | [2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 2-acetamido-3-(4-nitrooxybutanoylsulfanyl)propanoate |
| SMILES | CC(=O)NC(CSC(=O)CCCO[N+](=O)[O-])C(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C |
| InChI | InChI=1S/C30H42N2O11S/c1-17(33)31-22(16-44-25(37)5-4-12-43-32(40)41)27(38)42-15-24(36)30(39)11-9-21-20-7-6-18-13-19(34)8-10-28(18,2)26(20)23(35)14-29(21,30)3/h13,20-23,26,35,39H,4-12,14-16H2,1-3H3,(H,31,33) |
| InChIKey | CJOWTGBVDRGBMP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 199.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|