About 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol
10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol (PubChem CID 20805190) has the molecular formula C24H50O4S
and a molecular weight of 434.73 g/mol. Its IUPAC name is 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol.
Molecular Properties
| Compound Name | 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol |
| PubChem CID | 20805190 |
| Molecular Formula | C24H50O4S |
| Molecular Weight | 434.73 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol |
| SMILES | CC(C)(CCCCCO)CCCCOCCCCC(C)(C)CCCCS(C)(=O)=O |
| InChI | InChI=1S/C24H50O4S/c1-23(2,15-7-6-11-19-25)16-8-12-20-28-21-13-9-17-24(3,4)18-10-14-22-29(5,26)27/h25H,6-22H2,1-5H3 |
| InChIKey | OSLBUZWLZUXAKD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.73 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol?
The IUPAC name of 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol (CID 20805190) is 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol.
What is the SMILES notation for 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol?
The canonical SMILES for 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol is CC(C)(CCCCCO)CCCCOCCCCC(C)(C)CCCCS(C)(=O)=O.
What is the InChIKey of 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol?
The InChIKey is OSLBUZWLZUXAKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50O4S/c1-23(2,15-7-6-11-19-25)16-8-12-20-28-21-13-9-17-24(3,4)18-10-14-22-29(5,26)27/h25H,6-22H2,1-5H3.
What are the key properties of 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol?
10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol has a molecular weight of 434.73 g/mol, XLogP of 6.16, 20 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(5,5-dimethyl-9-methylsulfonylnonoxy)-6,6-dimethyldecan-1-ol is sourced from PubChem (CID 20805190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).