C8H6F3N2O3- — CID 20805366
N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2,2,2-trifluoroethanimidate (PubChem CID 20805366) has the molecular formula C8H6F3N2O3- and a molecular weight of 235.14 g/mol. Its IUPAC name is N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2,2,2-trifluoroethanimidate.
| Compound Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2,2,2-trifluoroethanimidate |
|---|---|
| PubChem CID | 20805366 |
| Molecular Formula | C8H6F3N2O3- |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2,2,2-trifluoroethanimidate |
| SMILES | O=C1C=CC(=O)N1CC/N=C(\[O-])C(F)(F)F |
| InChI | InChI=1S/C8H7F3N2O3/c9-8(10,11)7(16)12-3-4-13-5(14)1-2-6(13)15/h1-2H,3-4H2,(H,12,16)/p-1 |
| InChIKey | SUMFXENMMULQCX-UHFFFAOYSA-M |
| XLogP | -0.77 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|