About 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine
7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine (PubChem CID 20805892) has the molecular formula C22H29N3O4S
and a molecular weight of 431.56 g/mol. Its IUPAC name is 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine.
Molecular Properties
| Compound Name | 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine |
| PubChem CID | 20805892 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine |
| SMILES | CCOCCOc1ccc(-c2cc3nccn3c(SCC)n2)cc1OCCOCC |
| InChI | InChI=1S/C22H29N3O4S/c1-4-26-11-13-28-19-8-7-17(15-20(19)29-14-12-27-5-2)18-16-21-23-9-10-25(21)22(24-18)30-6-3/h7-10,15-16H,4-6,11-14H2,1-3H3 |
| InChIKey | VTAFVYMFBQDQJU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 67.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine?
The IUPAC name of 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine (CID 20805892) is 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine.
What is the SMILES notation for 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine?
The canonical SMILES for 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine is CCOCCOc1ccc(-c2cc3nccn3c(SCC)n2)cc1OCCOCC.
What is the InChIKey of 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine?
The InChIKey is VTAFVYMFBQDQJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O4S/c1-4-26-11-13-28-19-8-7-17(15-20(19)29-14-12-27-5-2)18-16-21-23-9-10-25(21)22(24-18)30-6-3/h7-10,15-16H,4-6,11-14H2,1-3H3.
What are the key properties of 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine?
7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine has a molecular weight of 431.56 g/mol, XLogP of 4.34, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3,4-bis(2-ethoxyethoxy)phenyl]-5-ethylsulfanylimidazo[1,2-c]pyrimidine is sourced from PubChem (CID 20805892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).