C24H34F2N4O4S — CID 20806540
4-ethyl-5,5-difluoro-3-methyl-N-[2-[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-2H-pyrrole-1-carboxamide (PubChem CID 20806540) has the molecular formula C24H34F2N4O4S and a molecular weight of 512.62 g/mol. Its IUPAC name is 4-ethyl-5,5-difluoro-3-methyl-N-[2-[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-2H-pyrrole-1-carboxamide.
| Compound Name | 4-ethyl-5,5-difluoro-3-methyl-N-[2-[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-2H-pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 20806540 |
| Molecular Formula | C24H34F2N4O4S |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 4-ethyl-5,5-difluoro-3-methyl-N-[2-[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-2H-pyrrole-1-carboxamide |
| SMILES | CCC1=C(C)CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC3CCC(C)CC3)cc2)C1(F)F |
| InChI | InChI=1S/C24H34F2N4O4S/c1-4-21-17(3)15-30(24(21,25)26)23(32)27-14-13-18-7-11-20(12-8-18)35(33,34)29-22(31)28-19-9-5-16(2)6-10-19/h7-8,11-12,16,19H,4-6,9-10,13-15H2,1-3H3,(H,27,32)(H2,28,29,31) |
| InChIKey | LEURVEGFCHGCEE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|