About 3-fluorobut-3-en-1-ol
3-fluorobut-3-en-1-ol (PubChem CID 20806740) has the molecular formula C4H7FO
and a molecular weight of 90.10 g/mol. Its IUPAC name is 3-fluorobut-3-en-1-ol.
Molecular Properties
| Compound Name | 3-fluorobut-3-en-1-ol |
| PubChem CID | 20806740 |
| Molecular Formula | C4H7FO |
| Molecular Weight | 90.10 g/mol |
| Exact Mass | 90.05 |
| IUPAC Name | 3-fluorobut-3-en-1-ol |
| SMILES | C=C(F)CCO |
| InChI | InChI=1S/C4H7FO/c1-4(5)2-3-6/h6H,1-3H2 |
| InChIKey | PSFNCYUGFYPKSV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.10 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluorobut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluorobut-3-en-1-ol?
The IUPAC name of 3-fluorobut-3-en-1-ol (CID 20806740) is 3-fluorobut-3-en-1-ol.
What is the SMILES notation for 3-fluorobut-3-en-1-ol?
The canonical SMILES for 3-fluorobut-3-en-1-ol is C=C(F)CCO.
What is the InChIKey of 3-fluorobut-3-en-1-ol?
The InChIKey is PSFNCYUGFYPKSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7FO/c1-4(5)2-3-6/h6H,1-3H2.
What are the key properties of 3-fluorobut-3-en-1-ol?
3-fluorobut-3-en-1-ol has a molecular weight of 90.10 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorobut-3-en-1-ol is sourced from PubChem (CID 20806740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).