About 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene
2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene (PubChem CID 20806749) has the molecular formula C12H21FFeO
and a molecular weight of 256.14 g/mol. Its IUPAC name is 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene.
Molecular Properties
| Compound Name | 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene |
| PubChem CID | 20806749 |
| Molecular Formula | C12H21FFeO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene |
| SMILES | C/[C-]=C(/C)F.C[CH-]COC(C)=C(C)C.[Fe+2] |
| InChI | InChI=1S/C8H15O.C4H6F.Fe/c1-5-6-9-8(4)7(2)3;1-3-4(2)5;/h5H,6H2,1-4H3;1-2H3;/q2*-1;+2 |
| InChIKey | IQDYNAVSBHPFAP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene?
The IUPAC name of 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene (CID 20806749) is 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene.
What is the SMILES notation for 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene?
The canonical SMILES for 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene is C/[C-]=C(/C)F.C[CH-]COC(C)=C(C)C.[Fe+2].
What is the InChIKey of 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene?
The InChIKey is IQDYNAVSBHPFAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O.C4H6F.Fe/c1-5-6-9-8(4)7(2)3;1-3-4(2)5;/h5H,6H2,1-4H3;1-2H3;/q2*-1;+2.
What are the key properties of 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene?
2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene has a molecular weight of 256.14 g/mol, XLogP of 4.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobut-2-ene;iron(2+);2-methyl-3-propoxybut-2-ene is sourced from PubChem (CID 20806749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).