C25H23N3O3S — CID 2080681
2-(4-methylphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide (PubChem CID 2080681) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-methylphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2080681 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-(4-methylphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCCc3ccc(S(N)(=O)=O)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H23N3O3S/c1-17-6-10-19(11-7-17)24-16-22(21-4-2-3-5-23(21)28-24)25(29)27-15-14-18-8-12-20(13-9-18)32(26,30)31/h2-13,16H,14-15H2,1H3,(H,27,29)(H2,26,30,31) |
| InChIKey | UUYSYWCUZMIJRL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |